C25H32N3O5S- — CID 66997439
4-[[4-(cyclohexanecarbonylamino)naphthalen-1-yl]-sulfinatoamino]-1-ethoxycarbonylpiperidine (PubChem CID 66997439) has the molecular formula C25H32N3O5S- and a molecular weight of 486.61 g/mol. Its IUPAC name is 4-[[4-(cyclohexanecarbonylamino)naphthalen-1-yl]-sulfinatoamino]-1-ethoxycarbonylpiperidine.
| Compound Name | 4-[[4-(cyclohexanecarbonylamino)naphthalen-1-yl]-sulfinatoamino]-1-ethoxycarbonylpiperidine |
|---|---|
| PubChem CID | 66997439 |
| Molecular Formula | C25H32N3O5S- |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 4-[[4-(cyclohexanecarbonylamino)naphthalen-1-yl]-sulfinatoamino]-1-ethoxycarbonylpiperidine |
| SMILES | CCOC(=O)N1CCC(N(c2ccc(NC(=O)C3CCCCC3)c3ccccc23)S(=O)[O-])CC1 |
| InChI | InChI=1S/C25H33N3O5S/c1-2-33-25(30)27-16-14-19(15-17-27)28(34(31)32)23-13-12-22(20-10-6-7-11-21(20)23)26-24(29)18-8-4-3-5-9-18/h6-7,10-13,18-19H,2-5,8-9,14-17H2,1H3,(H,26,29)(H,31,32)/p-1 |
| InChIKey | CVTLYJNWCPXIRS-UHFFFAOYSA-M |
| XLogP | 4.58 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|