C25H33N3O5S — CID 66998237
4-[[5-(cyclohexanecarbonylamino)naphthalen-1-yl]-sulfinoamino]-1-ethoxycarbonylpiperidine (PubChem CID 66998237) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is 4-[[5-(cyclohexanecarbonylamino)naphthalen-1-yl]-sulfinoamino]-1-ethoxycarbonylpiperidine.
| Compound Name | 4-[[5-(cyclohexanecarbonylamino)naphthalen-1-yl]-sulfinoamino]-1-ethoxycarbonylpiperidine |
|---|---|
| PubChem CID | 66998237 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 4-[[5-(cyclohexanecarbonylamino)naphthalen-1-yl]-sulfinoamino]-1-ethoxycarbonylpiperidine |
| SMILES | CCOC(=O)N1CCC(N(c2cccc3c(NC(=O)C4CCCCC4)cccc23)S(=O)O)CC1 |
| InChI | InChI=1S/C25H33N3O5S/c1-2-33-25(30)27-16-14-19(15-17-27)28(34(31)32)23-13-7-10-20-21(23)11-6-12-22(20)26-24(29)18-8-4-3-5-9-18/h6-7,10-13,18-19H,2-5,8-9,14-17H2,1H3,(H,26,29)(H,31,32) |
| InChIKey | LZDOADKKQJPULS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|