C15H18F2N2O3 — CID 60596637
ethyl 3-[(2,3-difluorophenyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 60596637) has the molecular formula C15H18F2N2O3 and a molecular weight of 312.32 g/mol. Its IUPAC name is ethyl 3-[(2,3-difluorophenyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 3-[(2,3-difluorophenyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 60596637 |
| Molecular Formula | C15H18F2N2O3 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | ethyl 3-[(2,3-difluorophenyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(C(=O)Nc2cccc(F)c2F)C1 |
| InChI | InChI=1S/C15H18F2N2O3/c1-2-22-15(21)19-8-4-5-10(9-19)14(20)18-12-7-3-6-11(16)13(12)17/h3,6-7,10H,2,4-5,8-9H2,1H3,(H,18,20) |
| InChIKey | IOGVUYVOQNBTFJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |