C14H19N3O3 — CID 46578071
ethyl 3-(pyridin-2-ylcarbamoyl)piperidine-1-carboxylate (PubChem CID 46578071) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is ethyl 3-(pyridin-2-ylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | ethyl 3-(pyridin-2-ylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46578071 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | ethyl 3-(pyridin-2-ylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(C(=O)Nc2ccccn2)C1 |
| InChI | InChI=1S/C14H19N3O3/c1-2-20-14(19)17-9-5-6-11(10-17)13(18)16-12-7-3-4-8-15-12/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,15,16,18) |
| InChIKey | IXJYCALZSSBJKX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |