C18H26N4O2 — CID 95154562
(3R)-3-N-cyclohexyl-1-N-pyridin-2-ylpiperidine-1,3-dicarboxamide (PubChem CID 95154562) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3R)-3-N-cyclohexyl-1-N-pyridin-2-ylpiperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-cyclohexyl-1-N-pyridin-2-ylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95154562 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (3R)-3-N-cyclohexyl-1-N-pyridin-2-ylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)[C@@H]1CCCN(C(=O)Nc2ccccn2)C1 |
| InChI | InChI=1S/C18H26N4O2/c23-17(20-15-8-2-1-3-9-15)14-7-6-12-22(13-14)18(24)21-16-10-4-5-11-19-16/h4-5,10-11,14-15H,1-3,6-9,12-13H2,(H,20,23)(H,19,21,24)/t14-/m1/s1 |
| InChIKey | OERYRUYZAYHICI-CQSZACIVSA-N |
| XLogP | 2.77 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |