C20H24N4O3 — CID 55810089
1-(2-ethoxypyridine-3-carbonyl)-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 55810089) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-(2-ethoxypyridine-3-carbonyl)-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-(2-ethoxypyridine-3-carbonyl)-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55810089 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-(2-ethoxypyridine-3-carbonyl)-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | CCOc1ncccc1C(=O)N1CCCC(C(=O)Nc2ccc(C)cn2)C1 |
| InChI | InChI=1S/C20H24N4O3/c1-3-27-19-16(7-4-10-21-19)20(26)24-11-5-6-15(13-24)18(25)23-17-9-8-14(2)12-22-17/h4,7-10,12,15H,3,5-6,11,13H2,1-2H3,(H,22,23,25) |
| InChIKey | YIXZMKARZFQTEF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |