C26H37N3O4S — CID 66998639
4-[[4-[(cyclohexylmethylamino)methyl]naphthalen-1-yl]-sulfinoamino]-1-ethoxycarbonylpiperidine (PubChem CID 66998639) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is 4-[[4-[(cyclohexylmethylamino)methyl]naphthalen-1-yl]-sulfinoamino]-1-ethoxycarbonylpiperidine.
| Compound Name | 4-[[4-[(cyclohexylmethylamino)methyl]naphthalen-1-yl]-sulfinoamino]-1-ethoxycarbonylpiperidine |
|---|---|
| PubChem CID | 66998639 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 4-[[4-[(cyclohexylmethylamino)methyl]naphthalen-1-yl]-sulfinoamino]-1-ethoxycarbonylpiperidine |
| SMILES | CCOC(=O)N1CCC(N(c2ccc(CNCC3CCCCC3)c3ccccc23)S(=O)O)CC1 |
| InChI | InChI=1S/C26H37N3O4S/c1-2-33-26(30)28-16-14-22(15-17-28)29(34(31)32)25-13-12-21(23-10-6-7-11-24(23)25)19-27-18-20-8-4-3-5-9-20/h6-7,10-13,20,22,27H,2-5,8-9,14-19H2,1H3,(H,31,32) |
| InChIKey | PKRNDJRUBDNAFS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|