C19H28N2O4 — CID 31844266
ethyl 4-[3-(2-ethoxyphenyl)propanoylamino]piperidine-1-carboxylate (PubChem CID 31844266) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is ethyl 4-[3-(2-ethoxyphenyl)propanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-(2-ethoxyphenyl)propanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 31844266 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | ethyl 4-[3-(2-ethoxyphenyl)propanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCc2ccccc2OCC)CC1 |
| InChI | InChI=1S/C19H28N2O4/c1-3-24-17-8-6-5-7-15(17)9-10-18(22)20-16-11-13-21(14-12-16)19(23)25-4-2/h5-8,16H,3-4,9-14H2,1-2H3,(H,20,22) |
| InChIKey | LXJAXDMIHHXOLY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |