C20H31N3O4 — CID 109025237
ethyl 4-[[3-[2-(2-methoxyphenyl)ethylamino]-3-oxopropyl]amino]piperidine-1-carboxylate (PubChem CID 109025237) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is ethyl 4-[[3-[2-(2-methoxyphenyl)ethylamino]-3-oxopropyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-[2-(2-methoxyphenyl)ethylamino]-3-oxopropyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109025237 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | ethyl 4-[[3-[2-(2-methoxyphenyl)ethylamino]-3-oxopropyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCCC(=O)NCCc2ccccc2OC)CC1 |
| InChI | InChI=1S/C20H31N3O4/c1-3-27-20(25)23-14-10-17(11-15-23)21-13-9-19(24)22-12-8-16-6-4-5-7-18(16)26-2/h4-7,17,21H,3,8-15H2,1-2H3,(H,22,24) |
| InChIKey | OPCVDTATLJXRQG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |