C19H28N4O5 — CID 110625494
ethyl 4-[2-[2-(2-methoxyphenyl)ethylcarbamoylamino]acetyl]piperazine-1-carboxylate (PubChem CID 110625494) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is ethyl 4-[2-[2-(2-methoxyphenyl)ethylcarbamoylamino]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[2-(2-methoxyphenyl)ethylcarbamoylamino]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110625494 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | ethyl 4-[2-[2-(2-methoxyphenyl)ethylcarbamoylamino]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CNC(=O)NCCc2ccccc2OC)CC1 |
| InChI | InChI=1S/C19H28N4O5/c1-3-28-19(26)23-12-10-22(11-13-23)17(24)14-21-18(25)20-9-8-15-6-4-5-7-16(15)27-2/h4-7H,3,8-14H2,1-2H3,(H2,20,21,25) |
| InChIKey | NYLICQRXAYRNPI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |