C19H27N3O5 — CID 109028976
ethyl 4-[[3-(2-methoxycarbonylanilino)-3-oxopropyl]amino]piperidine-1-carboxylate (PubChem CID 109028976) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is ethyl 4-[[3-(2-methoxycarbonylanilino)-3-oxopropyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-(2-methoxycarbonylanilino)-3-oxopropyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109028976 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethyl 4-[[3-(2-methoxycarbonylanilino)-3-oxopropyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCCC(=O)Nc2ccccc2C(=O)OC)CC1 |
| InChI | InChI=1S/C19H27N3O5/c1-3-27-19(25)22-12-9-14(10-13-22)20-11-8-17(23)21-16-7-5-4-6-15(16)18(24)26-2/h4-7,14,20H,3,8-13H2,1-2H3,(H,21,23) |
| InChIKey | BXTURYNGFKCLRE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |