C25H29N4O4S- — CID 66998542
2-[[[4-[(1-ethoxycarbonylpiperidin-4-yl)-sulfinatoamino]naphthalen-1-yl]methylamino]methyl]pyridine (PubChem CID 66998542) has the molecular formula C25H29N4O4S- and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-[[[4-[(1-ethoxycarbonylpiperidin-4-yl)-sulfinatoamino]naphthalen-1-yl]methylamino]methyl]pyridine.
| Compound Name | 2-[[[4-[(1-ethoxycarbonylpiperidin-4-yl)-sulfinatoamino]naphthalen-1-yl]methylamino]methyl]pyridine |
|---|---|
| PubChem CID | 66998542 |
| Molecular Formula | C25H29N4O4S- |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 2-[[[4-[(1-ethoxycarbonylpiperidin-4-yl)-sulfinatoamino]naphthalen-1-yl]methylamino]methyl]pyridine |
| SMILES | CCOC(=O)N1CCC(N(c2ccc(CNCc3ccccn3)c3ccccc23)S(=O)[O-])CC1 |
| InChI | InChI=1S/C25H30N4O4S/c1-2-33-25(30)28-15-12-21(13-16-28)29(34(31)32)24-11-10-19(22-8-3-4-9-23(22)24)17-26-18-20-7-5-6-14-27-20/h3-11,14,21,26H,2,12-13,15-18H2,1H3,(H,31,32)/p-1 |
| InChIKey | CUODPIACCCSXIK-UHFFFAOYSA-M |
| XLogP | 3.75 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|