C18H27N3O6 — CID 18999979
[2-ethoxy-3-(pyridin-2-ylmethylcarbamoyloxy)propyl] 4-hydroxypiperidine-1-carboxylate (PubChem CID 18999979) has the molecular formula C18H27N3O6 and a molecular weight of 381.43 g/mol. Its IUPAC name is [2-ethoxy-3-(pyridin-2-ylmethylcarbamoyloxy)propyl] 4-hydroxypiperidine-1-carboxylate.
| Compound Name | [2-ethoxy-3-(pyridin-2-ylmethylcarbamoyloxy)propyl] 4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 18999979 |
| Molecular Formula | C18H27N3O6 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [2-ethoxy-3-(pyridin-2-ylmethylcarbamoyloxy)propyl] 4-hydroxypiperidine-1-carboxylate |
| SMILES | CCOC(COC(=O)NCc1ccccn1)COC(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C18H27N3O6/c1-2-25-16(13-27-18(24)21-9-6-15(22)7-10-21)12-26-17(23)20-11-14-5-3-4-8-19-14/h3-5,8,15-16,22H,2,6-7,9-13H2,1H3,(H,20,23) |
| InChIKey | UQXMXDVYPAWLEB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |