C25H43N5O6 — CID 19000023
[2-methoxy-3-(pyridin-2-ylmethylcarbamoyloxy)propyl] N-[10-(dimethylcarbamoylamino)decyl]carbamate (PubChem CID 19000023) has the molecular formula C25H43N5O6 and a molecular weight of 509.65 g/mol. Its IUPAC name is [2-methoxy-3-(pyridin-2-ylmethylcarbamoyloxy)propyl] N-[10-(dimethylcarbamoylamino)decyl]carbamate.
| Compound Name | [2-methoxy-3-(pyridin-2-ylmethylcarbamoyloxy)propyl] N-[10-(dimethylcarbamoylamino)decyl]carbamate |
|---|---|
| PubChem CID | 19000023 |
| Molecular Formula | C25H43N5O6 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | [2-methoxy-3-(pyridin-2-ylmethylcarbamoyloxy)propyl] N-[10-(dimethylcarbamoylamino)decyl]carbamate |
| SMILES | COC(COC(=O)NCCCCCCCCCCNC(=O)N(C)C)COC(=O)NCc1ccccn1 |
| InChI | InChI=1S/C25H43N5O6/c1-30(2)23(31)27-16-11-8-6-4-5-7-9-12-17-28-24(32)35-19-22(34-3)20-36-25(33)29-18-21-14-10-13-15-26-21/h10,13-15,22H,4-9,11-12,16-20H2,1-3H3,(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | HYGPZRUMDUKGGG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|