C14H21N3O6 — CID 67808772
[3-hydroxy-2-(pyridin-2-ylmethylcarbamoyloxy)propyl] N-(3-hydroxypropyl)carbamate (PubChem CID 67808772) has the molecular formula C14H21N3O6 and a molecular weight of 327.34 g/mol. Its IUPAC name is [3-hydroxy-2-(pyridin-2-ylmethylcarbamoyloxy)propyl] N-(3-hydroxypropyl)carbamate.
| Compound Name | [3-hydroxy-2-(pyridin-2-ylmethylcarbamoyloxy)propyl] N-(3-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 67808772 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [3-hydroxy-2-(pyridin-2-ylmethylcarbamoyloxy)propyl] N-(3-hydroxypropyl)carbamate |
| SMILES | O=C(NCCCO)OCC(CO)OC(=O)NCc1ccccn1 |
| InChI | InChI=1S/C14H21N3O6/c18-7-3-6-16-13(20)22-10-12(9-19)23-14(21)17-8-11-4-1-2-5-15-11/h1-2,4-5,12,18-19H,3,6-10H2,(H,16,20)(H,17,21) |
| InChIKey | QRQKRJBGCKEBAS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|