C20H25N3O2S — CID 10571278
ethyl 4-[methyl(naphthalen-1-ylcarbamothioyl)amino]piperidine-1-carboxylate (PubChem CID 10571278) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is ethyl 4-[methyl(naphthalen-1-ylcarbamothioyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[methyl(naphthalen-1-ylcarbamothioyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10571278 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | ethyl 4-[methyl(naphthalen-1-ylcarbamothioyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(C)C(=S)Nc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C20H25N3O2S/c1-3-25-20(24)23-13-11-16(12-14-23)22(2)19(26)21-18-10-6-8-15-7-4-5-9-17(15)18/h4-10,16H,3,11-14H2,1-2H3,(H,21,26) |
| InChIKey | FURWQQRFJQGEDY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|