C17H26N3O3+ — CID 4745816
ethyl 4-[3-(2-methylanilino)-3-oxopropyl]piperazin-4-ium-1-carboxylate (PubChem CID 4745816) has the molecular formula C17H26N3O3+ and a molecular weight of 320.41 g/mol. Its IUPAC name is ethyl 4-[3-(2-methylanilino)-3-oxopropyl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[3-(2-methylanilino)-3-oxopropyl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 4745816 |
| Molecular Formula | C17H26N3O3+ |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | ethyl 4-[3-(2-methylanilino)-3-oxopropyl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+](CCC(=O)Nc2ccccc2C)CC1 |
| InChI | InChI=1S/C17H25N3O3/c1-3-23-17(22)20-12-10-19(11-13-20)9-8-16(21)18-15-7-5-4-6-14(15)2/h4-7H,3,8-13H2,1-2H3,(H,18,21)/p+1 |
| InChIKey | NFXDDEAYANERRX-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |