C17H24N3O4+ — CID 8932316
ethyl 4-[2-(2-acetylanilino)-2-oxoethyl]piperazin-4-ium-1-carboxylate (PubChem CID 8932316) has the molecular formula C17H24N3O4+ and a molecular weight of 334.40 g/mol. Its IUPAC name is ethyl 4-[2-(2-acetylanilino)-2-oxoethyl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-acetylanilino)-2-oxoethyl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 8932316 |
| Molecular Formula | C17H24N3O4+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | ethyl 4-[2-(2-acetylanilino)-2-oxoethyl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+](CC(=O)Nc2ccccc2C(C)=O)CC1 |
| InChI | InChI=1S/C17H23N3O4/c1-3-24-17(23)20-10-8-19(9-11-20)12-16(22)18-15-7-5-4-6-14(15)13(2)21/h4-7H,3,8-12H2,1-2H3,(H,18,22)/p+1 |
| InChIKey | MIYLSDJNMHDHIQ-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |