C15H21IN3O3+ — CID 8932278
ethyl 4-[2-(3-iodoanilino)-2-oxoethyl]piperazin-4-ium-1-carboxylate (PubChem CID 8932278) has the molecular formula C15H21IN3O3+ and a molecular weight of 418.26 g/mol. Its IUPAC name is ethyl 4-[2-(3-iodoanilino)-2-oxoethyl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[2-(3-iodoanilino)-2-oxoethyl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 8932278 |
| Molecular Formula | C15H21IN3O3+ |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | ethyl 4-[2-(3-iodoanilino)-2-oxoethyl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+](CC(=O)Nc2cccc(I)c2)CC1 |
| InChI | InChI=1S/C15H20IN3O3/c1-2-22-15(21)19-8-6-18(7-9-19)11-14(20)17-13-5-3-4-12(16)10-13/h3-5,10H,2,6-9,11H2,1H3,(H,17,20)/p+1 |
| InChIKey | HWRUAUAYNAJHQK-UHFFFAOYSA-O |
| XLogP | 0.59 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|