C16H22F2N3O4+ — CID 8932294
ethyl 4-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]piperazin-4-ium-1-carboxylate (PubChem CID 8932294) has the molecular formula C16H22F2N3O4+ and a molecular weight of 358.37 g/mol. Its IUPAC name is ethyl 4-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 8932294 |
| Molecular Formula | C16H22F2N3O4+ |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | ethyl 4-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+](CC(=O)Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H21F2N3O4/c1-2-24-16(23)21-9-7-20(8-10-21)11-14(22)19-12-3-5-13(6-4-12)25-15(17)18/h3-6,15H,2,7-11H2,1H3,(H,19,22)/p+1 |
| InChIKey | CHHSLTIWZOADNN-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |