C20H33ClN4O3S — CID 88985999
tert-butyl 4-[(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl-cyclohexylamino]piperidine-1-carboxylate (PubChem CID 88985999) has the molecular formula C20H33ClN4O3S and a molecular weight of 445.03 g/mol. Its IUPAC name is tert-butyl 4-[(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl-cyclohexylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl-cyclohexylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 88985999 |
| Molecular Formula | C20H33ClN4O3S |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | tert-butyl 4-[(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl-cyclohexylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(C(=O)NC2=NCC(Cl)S2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H33ClN4O3S/c1-20(2,3)28-19(27)24-11-9-15(10-12-24)25(14-7-5-4-6-8-14)18(26)23-17-22-13-16(21)29-17/h14-16H,4-13H2,1-3H3,(H,22,23,26) |
| InChIKey | KJQBFOWPSCONLO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|