C21H35ClN4O2S — CID 88985951
3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-(4-methylcyclohexyl)-1-(1-pentanoylpiperidin-4-yl)urea (PubChem CID 88985951) has the molecular formula C21H35ClN4O2S and a molecular weight of 443.06 g/mol. Its IUPAC name is 3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-(4-methylcyclohexyl)-1-(1-pentanoylpiperidin-4-yl)urea.
| Compound Name | 3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-(4-methylcyclohexyl)-1-(1-pentanoylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 88985951 |
| Molecular Formula | C21H35ClN4O2S |
| Molecular Weight | 443.06 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-(4-methylcyclohexyl)-1-(1-pentanoylpiperidin-4-yl)urea |
| SMILES | CCCCC(=O)N1CCC(N(C(=O)NC2=NCC(Cl)S2)C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C21H35ClN4O2S/c1-3-4-5-19(27)25-12-10-17(11-13-25)26(16-8-6-15(2)7-9-16)21(28)24-20-23-14-18(22)29-20/h15-18H,3-14H2,1-2H3,(H,23,24,28) |
| InChIKey | VYPXMIXQXORSPB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.06 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|