C20H33ClN4O2S — CID 88985986
3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1-pentanoylpiperidin-4-yl)urea (PubChem CID 88985986) has the molecular formula C20H33ClN4O2S and a molecular weight of 429.03 g/mol. Its IUPAC name is 3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1-pentanoylpiperidin-4-yl)urea.
| Compound Name | 3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1-pentanoylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 88985986 |
| Molecular Formula | C20H33ClN4O2S |
| Molecular Weight | 429.03 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1-pentanoylpiperidin-4-yl)urea |
| SMILES | CCCCC(=O)N1CCC(N(C(=O)NC2=NCC(Cl)S2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H33ClN4O2S/c1-2-3-9-18(26)24-12-10-16(11-13-24)25(15-7-5-4-6-8-15)20(27)23-19-22-14-17(21)28-19/h15-17H,2-14H2,1H3,(H,22,23,27) |
| InChIKey | JJZNTJBBKBMIIX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.03 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|