C20H31ClN4O2S — CID 88986001
3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-[1-(cyclobutanecarbonyl)piperidin-4-yl]-1-cyclohexylurea (PubChem CID 88986001) has the molecular formula C20H31ClN4O2S and a molecular weight of 427.01 g/mol. Its IUPAC name is 3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-[1-(cyclobutanecarbonyl)piperidin-4-yl]-1-cyclohexylurea.
| Compound Name | 3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-[1-(cyclobutanecarbonyl)piperidin-4-yl]-1-cyclohexylurea |
|---|---|
| PubChem CID | 88986001 |
| Molecular Formula | C20H31ClN4O2S |
| Molecular Weight | 427.01 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-(5-chloro-4,5-dihydro-1,3-thiazol-2-yl)-1-[1-(cyclobutanecarbonyl)piperidin-4-yl]-1-cyclohexylurea |
| SMILES | O=C(C1CCC1)N1CCC(N(C(=O)NC2=NCC(Cl)S2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H31ClN4O2S/c21-17-13-22-19(28-17)23-20(27)25(15-7-2-1-3-8-15)16-9-11-24(12-10-16)18(26)14-5-4-6-14/h14-17H,1-13H2,(H,22,23,27) |
| InChIKey | OABFTLHQWIDYLY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.01 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|