C19H29ClN4O2S — CID 143074837
3-[[(E)-2-chloroethenyl]carbamothioyl]-1-cyclohexyl-1-[1-(cyclopropanecarbonyl)piperidin-4-yl]urea (PubChem CID 143074837) has the molecular formula C19H29ClN4O2S and a molecular weight of 412.99 g/mol. Its IUPAC name is 3-[[(E)-2-chloroethenyl]carbamothioyl]-1-cyclohexyl-1-[1-(cyclopropanecarbonyl)piperidin-4-yl]urea.
| Compound Name | 3-[[(E)-2-chloroethenyl]carbamothioyl]-1-cyclohexyl-1-[1-(cyclopropanecarbonyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 143074837 |
| Molecular Formula | C19H29ClN4O2S |
| Molecular Weight | 412.99 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-[[(E)-2-chloroethenyl]carbamothioyl]-1-cyclohexyl-1-[1-(cyclopropanecarbonyl)piperidin-4-yl]urea |
| SMILES | O=C(C1CC1)N1CCC(N(C(=O)NC(=S)N/C=C/Cl)C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H29ClN4O2S/c20-10-11-21-18(27)22-19(26)24(15-4-2-1-3-5-15)16-8-12-23(13-9-16)17(25)14-6-7-14/h10-11,14-16H,1-9,12-13H2,(H2,21,22,26,27)/b11-10+ |
| InChIKey | XCFFNHAHDTYWRY-ZHACJKMWSA-N |
| XLogP | 3.32 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.99 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|