About but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone
but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone (PubChem CID 170583194) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone.
Molecular Properties
| Compound Name | but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone |
| PubChem CID | 170583194 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone |
| SMILES | CC#CC.O=C(C1CC1)N1CCCC1 |
| InChI | InChI=1S/C8H13NO.C4H6/c10-8(7-3-4-7)9-5-1-2-6-9;1-3-4-2/h7H,1-6H2;1-2H3 |
| InChIKey | IUTXQFUKAJRQIP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone?
The IUPAC name of but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone (CID 170583194) is but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone.
What is the SMILES notation for but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone?
The canonical SMILES for but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone is CC#CC.O=C(C1CC1)N1CCCC1.
What is the InChIKey of but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone?
The InChIKey is IUTXQFUKAJRQIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.C4H6/c10-8(7-3-4-7)9-5-1-2-6-9;1-3-4-2/h7H,1-6H2;1-2H3.
What are the key properties of but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone?
but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone has a molecular weight of 193.29 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-yne;cyclopropyl(pyrrolidin-1-yl)methanone is sourced from PubChem (CID 170583194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).