C9H15NOS — CID 60773784
cyclopropyl(1,4-thiazepan-4-yl)methanone (PubChem CID 60773784) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is cyclopropyl(1,4-thiazepan-4-yl)methanone.
| Compound Name | cyclopropyl(1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 60773784 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | cyclopropyl(1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(C1CC1)N1CCCSCC1 |
| InChI | InChI=1S/C9H15NOS/c11-9(8-2-3-8)10-4-1-6-12-7-5-10/h8H,1-7H2 |
| InChIKey | WTHNIOLGNPSGSG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |