C9H16N2OS — CID 130767550
azetidin-2-yl(1,4-thiazepan-4-yl)methanone (PubChem CID 130767550) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is azetidin-2-yl(1,4-thiazepan-4-yl)methanone.
| Compound Name | azetidin-2-yl(1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 130767550 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | azetidin-2-yl(1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(C1CCN1)N1CCCSCC1 |
| InChI | InChI=1S/C9H16N2OS/c12-9(8-2-3-10-8)11-4-1-6-13-7-5-11/h8,10H,1-7H2 |
| InChIKey | YWTBOZYSDIUWPO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |