C19H32N4O2S — CID 91342895
1-(1-acetylpiperidin-4-yl)-1-cyclohexyl-3-(1,3-thiazol-2-yl)urea;ethane (PubChem CID 91342895) has the molecular formula C19H32N4O2S and a molecular weight of 380.56 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-1-cyclohexyl-3-(1,3-thiazol-2-yl)urea;ethane.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-1-cyclohexyl-3-(1,3-thiazol-2-yl)urea;ethane |
|---|---|
| PubChem CID | 91342895 |
| Molecular Formula | C19H32N4O2S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-1-cyclohexyl-3-(1,3-thiazol-2-yl)urea;ethane |
| SMILES | CC.CC(=O)N1CCC(N(C(=O)Nc2nccs2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C17H26N4O2S.C2H6/c1-13(22)20-10-7-15(8-11-20)21(14-5-3-2-4-6-14)17(23)19-16-18-9-12-24-16;1-2/h9,12,14-15H,2-8,10-11H2,1H3,(H,18,19,23);1-2H3 |
| InChIKey | SVECGZIPXQFNMG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |