C11H16N2OS2 — CID 2434094
2-cyclohexylsulfanyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 2434094) has the molecular formula C11H16N2OS2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-cyclohexylsulfanyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2434094 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-cyclohexylsulfanyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSC1CCCCC1)Nc1nccs1 |
| InChI | InChI=1S/C11H16N2OS2/c14-10(13-11-12-6-7-15-11)8-16-9-4-2-1-3-5-9/h6-7,9H,1-5,8H2,(H,12,13,14) |
| InChIKey | JRPOFFNYARYKLG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |