C14H19NOS — CID 23932731
2-cyclohexylsulfanyl-N-phenylacetamide (PubChem CID 23932731) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-N-phenylacetamide.
| Compound Name | 2-cyclohexylsulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 23932731 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-cyclohexylsulfanyl-N-phenylacetamide |
| SMILES | O=C(CSC1CCCCC1)Nc1ccccc1 |
| InChI | InChI=1S/C14H19NOS/c16-14(15-12-7-3-1-4-8-12)11-17-13-9-5-2-6-10-13/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,15,16) |
| InChIKey | SFDYNPHJFRDILG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |