C19H28N2O2S — CID 8705826
4-[(2-cyclohexylsulfanylacetyl)amino]-N,N-diethylbenzamide (PubChem CID 8705826) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 4-[(2-cyclohexylsulfanylacetyl)amino]-N,N-diethylbenzamide.
| Compound Name | 4-[(2-cyclohexylsulfanylacetyl)amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 8705826 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 4-[(2-cyclohexylsulfanylacetyl)amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CSC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H28N2O2S/c1-3-21(4-2)19(23)15-10-12-16(13-11-15)20-18(22)14-24-17-8-6-5-7-9-17/h10-13,17H,3-9,14H2,1-2H3,(H,20,22) |
| InChIKey | NRXYUYHMRPDEBU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |