C17H25NOS — CID 134042023
2-cyclohexylsulfanyl-N-(3-propan-2-ylphenyl)acetamide (PubChem CID 134042023) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-N-(3-propan-2-ylphenyl)acetamide.
| Compound Name | 2-cyclohexylsulfanyl-N-(3-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 134042023 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-cyclohexylsulfanyl-N-(3-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1cccc(NC(=O)CSC2CCCCC2)c1 |
| InChI | InChI=1S/C17H25NOS/c1-13(2)14-7-6-8-15(11-14)18-17(19)12-20-16-9-4-3-5-10-16/h6-8,11,13,16H,3-5,9-10,12H2,1-2H3,(H,18,19) |
| InChIKey | BADOMTOIALCDQK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |