C16H24N2O3S2 — CID 8705717
2-cyclohexylsulfanyl-N-[3-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 8705717) has the molecular formula C16H24N2O3S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-N-[3-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-cyclohexylsulfanyl-N-[3-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8705717 |
| Molecular Formula | C16H24N2O3S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-cyclohexylsulfanyl-N-[3-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)CSC2CCCCC2)c1 |
| InChI | InChI=1S/C16H24N2O3S2/c1-18(2)23(20,21)15-10-6-7-13(11-15)17-16(19)12-22-14-8-4-3-5-9-14/h6-7,10-11,14H,3-5,8-9,12H2,1-2H3,(H,17,19) |
| InChIKey | XFEUFHFXQKLOHW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |