About 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide
2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 11186412) has the molecular formula C18H19N3OS
and a molecular weight of 325.44 g/mol. Its IUPAC name is 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 11186412 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cc1cn(C2CCCC2)c2ccccc12)Nc1nccs1 |
| InChI | InChI=1S/C18H19N3OS/c22-17(20-18-19-9-10-23-18)11-13-12-21(14-5-1-2-6-14)16-8-4-3-7-15(13)16/h3-4,7-10,12,14H,1-2,5-6,11H2,(H,19,20,22) |
| InChIKey | UJTYNDWTZJACCR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide (CID 11186412) is 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide is O=C(Cc1cn(C2CCCC2)c2ccccc12)Nc1nccs1.
What is the InChIKey of 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is UJTYNDWTZJACCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3OS/c22-17(20-18-19-9-10-23-18)11-13-12-21(14-5-1-2-6-14)16-8-4-3-7-15(13)16/h3-4,7-10,12,14H,1-2,5-6,11H2,(H,19,20,22).
What are the key properties of 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide?
2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 325.44 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopentylindol-3-yl)-N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 11186412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).