C17H19N3OS — CID 140983112
5-(1-methylindol-3-yl)-N-(1,3-thiazol-2-yl)pentanamide (PubChem CID 140983112) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is 5-(1-methylindol-3-yl)-N-(1,3-thiazol-2-yl)pentanamide.
| Compound Name | 5-(1-methylindol-3-yl)-N-(1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 140983112 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 5-(1-methylindol-3-yl)-N-(1,3-thiazol-2-yl)pentanamide |
| SMILES | Cn1cc(CCCCC(=O)Nc2nccs2)c2ccccc21 |
| InChI | InChI=1S/C17H19N3OS/c1-20-12-13(14-7-3-4-8-15(14)20)6-2-5-9-16(21)19-17-18-10-11-22-17/h3-4,7-8,10-12H,2,5-6,9H2,1H3,(H,18,19,21) |
| InChIKey | JWQVQMNOJLOVAJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|