C15H15N3OS2 — CID 18192870
5-(1,3-benzothiazol-2-yl)-N-(1,3-thiazol-2-yl)pentanamide (PubChem CID 18192870) has the molecular formula C15H15N3OS2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-(1,3-thiazol-2-yl)pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-(1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 18192870 |
| Molecular Formula | C15H15N3OS2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-(1,3-thiazol-2-yl)pentanamide |
| SMILES | O=C(CCCCc1nc2ccccc2s1)Nc1nccs1 |
| InChI | InChI=1S/C15H15N3OS2/c19-13(18-15-16-9-10-20-15)7-3-4-8-14-17-11-5-1-2-6-12(11)21-14/h1-2,5-6,9-10H,3-4,7-8H2,(H,16,18,19) |
| InChIKey | MWEYJALQCUXOBL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|