C15H13N3O3S — CID 719768
4-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 719768) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 719768 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1nccs1 |
| InChI | InChI=1S/C15H13N3O3S/c19-12(17-15-16-7-9-22-15)6-3-8-18-13(20)10-4-1-2-5-11(10)14(18)21/h1-2,4-5,7,9H,3,6,8H2,(H,16,17,19) |
| InChIKey | RFORQYKMCQHLLL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|