C11H14N4O3S — CID 8777159
4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 8777159) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 8777159 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)Nc2nccs2)C1=O |
| InChI | InChI=1S/C11H14N4O3S/c1-14-7-9(17)15(11(14)18)5-2-3-8(16)13-10-12-4-6-19-10/h4,6H,2-3,5,7H2,1H3,(H,12,13,16) |
| InChIKey | VMWMWALSWNKUGD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|