C16H15F6N3O3 — CID 9207191
N-[3,5-bis(trifluoromethyl)phenyl]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 9207191) has the molecular formula C16H15F6N3O3 and a molecular weight of 411.30 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 9207191 |
| Molecular Formula | C16H15F6N3O3 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C16H15F6N3O3/c1-24-8-13(27)25(14(24)28)4-2-3-12(26)23-11-6-9(15(17,18)19)5-10(7-11)16(20,21)22/h5-7H,2-4,8H2,1H3,(H,23,26) |
| InChIKey | IXVXLDHCNPJQFK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|