C11H17F2N3O4 — CID 104857752
N-(2,2-difluoro-3-hydroxypropyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 104857752) has the molecular formula C11H17F2N3O4 and a molecular weight of 293.27 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 104857752 |
| Molecular Formula | C11H17F2N3O4 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)NCC(F)(F)CO)C1=O |
| InChI | InChI=1S/C11H17F2N3O4/c1-15-5-9(19)16(10(15)20)4-2-3-8(18)14-6-11(12,13)7-17/h17H,2-7H2,1H3,(H,14,18) |
| InChIKey | ZRIZMGANAMLREL-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|