C10H16N4O5 — CID 112550669
N-(2-amino-2-oxoethoxy)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 112550669) has the molecular formula C10H16N4O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 112550669 |
| Molecular Formula | C10H16N4O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)NOCC(N)=O)C1=O |
| InChI | InChI=1S/C10H16N4O5/c1-13-5-9(17)14(10(13)18)4-2-3-8(16)12-19-6-7(11)15/h2-6H2,1H3,(H2,11,15)(H,12,16) |
| InChIKey | HCCZJJLGRVXVQG-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|