C8H12N4O5 — CID 112674291
N-(2-amino-2-oxoethoxy)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 112674291) has the molecular formula C8H12N4O5 and a molecular weight of 244.21 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 112674291 |
| Molecular Formula | C8H12N4O5 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1CC(=O)N(CC(=O)NOCC(N)=O)C1=O |
| InChI | InChI=1S/C8H12N4O5/c1-11-3-7(15)12(8(11)16)2-6(14)10-17-4-5(9)13/h2-4H2,1H3,(H2,9,13)(H,10,14) |
| InChIKey | FRLVGRZITJWCKU-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|