C7H11N3O4 — CID 60717733
2-(2,5-dioxoimidazolidin-1-yl)-N-ethoxyacetamide (PubChem CID 60717733) has the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-ethoxyacetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-ethoxyacetamide |
|---|---|
| PubChem CID | 60717733 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-ethoxyacetamide |
| SMILES | CCONC(=O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C7H11N3O4/c1-2-14-9-5(11)4-10-6(12)3-8-7(10)13/h2-4H2,1H3,(H,8,13)(H,9,11) |
| InChIKey | KPZZAVMRIQUIDT-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|