C11H19N3O5 — CID 79675454
N-(2-methoxyethoxy)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 79675454) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-(2-methoxyethoxy)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 79675454 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-(2-methoxyethoxy)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | COCCONC(=O)CCCN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C11H19N3O5/c1-13-8-10(16)14(11(13)17)5-3-4-9(15)12-19-7-6-18-2/h3-8H2,1-2H3,(H,12,15) |
| InChIKey | WXSYHHJVKPBPEC-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|