C10H16N2O3 — CID 106801687
1-methyl-3-(4-oxohexyl)imidazolidine-2,4-dione (PubChem CID 106801687) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-methyl-3-(4-oxohexyl)imidazolidine-2,4-dione.
| Compound Name | 1-methyl-3-(4-oxohexyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106801687 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-methyl-3-(4-oxohexyl)imidazolidine-2,4-dione |
| SMILES | CCC(=O)CCCN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C10H16N2O3/c1-3-8(13)5-4-6-12-9(14)7-11(2)10(12)15/h3-7H2,1-2H3 |
| InChIKey | WUBOTHZMXGAWGR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|