C12H17NO3S2 — CID 174154391
3,4-bis(methylsulfanyl)-1-(4-oxohexyl)pyrrole-2,5-dione (PubChem CID 174154391) has the molecular formula C12H17NO3S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 3,4-bis(methylsulfanyl)-1-(4-oxohexyl)pyrrole-2,5-dione.
| Compound Name | 3,4-bis(methylsulfanyl)-1-(4-oxohexyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 174154391 |
| Molecular Formula | C12H17NO3S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3,4-bis(methylsulfanyl)-1-(4-oxohexyl)pyrrole-2,5-dione |
| SMILES | CCC(=O)CCCN1C(=O)C(SC)=C(SC)C1=O |
| InChI | InChI=1S/C12H17NO3S2/c1-4-8(14)6-5-7-13-11(15)9(17-2)10(18-3)12(13)16/h4-7H2,1-3H3 |
| InChIKey | FXNLZOOMZMHJFD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|