C11H15F3N2O3 — CID 106801793
5-methyl-3-(4-oxohexyl)-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 106801793) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is 5-methyl-3-(4-oxohexyl)-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-(4-oxohexyl)-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106801793 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-methyl-3-(4-oxohexyl)-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | CCC(=O)CCCN1C(=O)NC(C)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C11H15F3N2O3/c1-3-7(17)5-4-6-16-8(18)10(2,11(12,13)14)15-9(16)19/h3-6H2,1-2H3,(H,15,19) |
| InChIKey | GMFHVMUCGUKJCG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|