C11H21N3O2 — CID 82147925
3-(3-aminopropyl)-5-tert-butyl-5-methylimidazolidine-2,4-dione (PubChem CID 82147925) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-(3-aminopropyl)-5-tert-butyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-(3-aminopropyl)-5-tert-butyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82147925 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 3-(3-aminopropyl)-5-tert-butyl-5-methylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)C1(C)NC(=O)N(CCCN)C1=O |
| InChI | InChI=1S/C11H21N3O2/c1-10(2,3)11(4)8(15)14(7-5-6-12)9(16)13-11/h5-7,12H2,1-4H3,(H,13,16) |
| InChIKey | SIPWLQNWBKYBEW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|