C10H19N3O2 — CID 82147926
3-(3-aminopropyl)-5-methyl-5-propan-2-ylimidazolidine-2,4-dione (PubChem CID 82147926) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-(3-aminopropyl)-5-methyl-5-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-(3-aminopropyl)-5-methyl-5-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82147926 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-(3-aminopropyl)-5-methyl-5-propan-2-ylimidazolidine-2,4-dione |
| SMILES | CC(C)C1(C)NC(=O)N(CCCN)C1=O |
| InChI | InChI=1S/C10H19N3O2/c1-7(2)10(3)8(14)13(6-4-5-11)9(15)12-10/h7H,4-6,11H2,1-3H3,(H,12,15) |
| InChIKey | DVXGKEJDPMRYED-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|